C21H18F2N2O — CID 8853634
(E)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one (PubChem CID 8853634) has the molecular formula C21H18F2N2O and a molecular weight of 352.38 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8853634 |
| Molecular Formula | C21H18F2N2O |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=C/C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C21H18F2N2O/c1-14-17(11-12-20(26)21-18(22)9-6-10-19(21)23)15(2)25(24-14)13-16-7-4-3-5-8-16/h3-12H,13H2,1-2H3/b12-11+ |
| InChIKey | AQMYSPDKLJYYJJ-VAWYXSNFSA-N |
| XLogP | 4.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|