C20H22N3+ — CID 6489998
2-[(E)-2-(1-benzyl-3,5-dimethylpyrazol-4-yl)ethenyl]-1-methylpyridin-1-ium (PubChem CID 6489998) has the molecular formula C20H22N3+ and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[(E)-2-(1-benzyl-3,5-dimethylpyrazol-4-yl)ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[(E)-2-(1-benzyl-3,5-dimethylpyrazol-4-yl)ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 6489998 |
| Molecular Formula | C20H22N3+ |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[(E)-2-(1-benzyl-3,5-dimethylpyrazol-4-yl)ethenyl]-1-methylpyridin-1-ium |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=C/c1cccc[n+]1C |
| InChI | InChI=1S/C20H22N3/c1-16-20(13-12-19-11-7-8-14-22(19)3)17(2)23(21-16)15-18-9-5-4-6-10-18/h4-14H,15H2,1-3H3/q+1 |
| InChIKey | QHQQYVKXHREPSJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|