C18H18IN2- — CID 53491199
1-benzyl-3,5-dimethyl-4-phenyliodanuidylpyrazole (PubChem CID 53491199) has the molecular formula C18H18IN2- and a molecular weight of 389.26 g/mol. Its IUPAC name is 1-benzyl-3,5-dimethyl-4-phenyliodanuidylpyrazole.
| Compound Name | 1-benzyl-3,5-dimethyl-4-phenyliodanuidylpyrazole |
|---|---|
| PubChem CID | 53491199 |
| Molecular Formula | C18H18IN2- |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 1-benzyl-3,5-dimethyl-4-phenyliodanuidylpyrazole |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1[I-]c1ccccc1 |
| InChI | InChI=1S/C18H18IN2/c1-14-18(19-17-11-7-4-8-12-17)15(2)21(20-14)13-16-9-5-3-6-10-16/h3-12H,13H2,1-2H3/q-1 |
| InChIKey | OUBYKDXVHVVISM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|