4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid

C20H20N2O2 — CID 84612805

IUPAC4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid
SMILESCc1nn(Cc2ccccc2)c(C)c1Cc1ccc(C(=O)O)cc1
InChIInChI=1S/C20H20N2O2/c1-14-19(12-16-8-10-18(11-9-16)20(23)24)15(2)22(21-14)13-17-6-4-3-5-7-17/h3-11H,12-13H2,1-2H3,(H,23,24)
InChIKeySJUUGLVQQJOEQV-UHFFFAOYSA-N
MW320.39 g/mol
LogP3.84
Rot. Bonds5

About 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid

4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid (PubChem CID 84612805) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid
PubChem CID84612805
Molecular FormulaC20H20N2O2
Molecular Weight320.39 g/mol
Exact Mass320.15
IUPAC Name4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid
SMILESCc1nn(Cc2ccccc2)c(C)c1Cc1ccc(C(=O)O)cc1
InChIInChI=1S/C20H20N2O2/c1-14-19(12-16-8-10-18(11-9-16)20(23)24)15(2)22(21-14)13-17-6-4-3-5-7-17/h3-11H,12-13H2,1-2H3,(H,23,24)
InChIKeySJUUGLVQQJOEQV-UHFFFAOYSA-N
XLogP3.84
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.39
LogP ≤ 53.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid?
The IUPAC name of 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid (CID 84612805) is 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid.
What is the SMILES notation for 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid?
The canonical SMILES for 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid is Cc1nn(Cc2ccccc2)c(C)c1Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid?
The InChIKey is SJUUGLVQQJOEQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-14-19(12-16-8-10-18(11-9-16)20(23)24)15(2)22(21-14)13-17-6-4-3-5-7-17/h3-11H,12-13H2,1-2H3,(H,23,24).
What are the key properties of 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid?
4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid has a molecular weight of 320.39 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]benzoic acid is sourced from PubChem (CID 84612805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).