C13H15ClN2O2 — CID 70610186
4-benzyl-3,5-dimethylpyrazole-1-carboxylic acid;hydrochloride (PubChem CID 70610186) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 4-benzyl-3,5-dimethylpyrazole-1-carboxylic acid;hydrochloride.
| Compound Name | 4-benzyl-3,5-dimethylpyrazole-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70610186 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-benzyl-3,5-dimethylpyrazole-1-carboxylic acid;hydrochloride |
| SMILES | Cc1nn(C(=O)O)c(C)c1Cc1ccccc1.Cl |
| InChI | InChI=1S/C13H14N2O2.ClH/c1-9-12(8-11-6-4-3-5-7-11)10(2)15(14-9)13(16)17;/h3-7H,8H2,1-2H3,(H,16,17);1H |
| InChIKey | JJEVJUYATSAHFY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |