4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid

C13H14N2S2 — CID 132993214

IUPAC4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid
SMILESCc1nn(C(=S)S)c(C)c1Cc1ccccc1
InChIInChI=1S/C13H14N2S2/c1-9-12(8-11-6-4-3-5-7-11)10(2)15(14-9)13(16)17/h3-7H,8H2,1-2H3,(H,16,17)
InChIKeyFUEIMQFQNAQCKP-UHFFFAOYSA-N
MW262.40 g/mol
LogP3.15
Rot. Bonds2

About 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid

4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid (PubChem CID 132993214) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid.

Molecular Properties

Compound Name4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid
PubChem CID132993214
Molecular FormulaC13H14N2S2
Molecular Weight262.40 g/mol
Exact Mass262.06
IUPAC Name4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid
SMILESCc1nn(C(=S)S)c(C)c1Cc1ccccc1
InChIInChI=1S/C13H14N2S2/c1-9-12(8-11-6-4-3-5-7-11)10(2)15(14-9)13(16)17/h3-7H,8H2,1-2H3,(H,16,17)
InChIKeyFUEIMQFQNAQCKP-UHFFFAOYSA-N
XLogP3.15
TPSA17.82 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.40
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid?
The IUPAC name of 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid (CID 132993214) is 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid.
What is the SMILES notation for 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid?
The canonical SMILES for 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid is Cc1nn(C(=S)S)c(C)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid?
The InChIKey is FUEIMQFQNAQCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S2/c1-9-12(8-11-6-4-3-5-7-11)10(2)15(14-9)13(16)17/h3-7H,8H2,1-2H3,(H,16,17).
What are the key properties of 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid?
4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid has a molecular weight of 262.40 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid is sourced from PubChem (CID 132993214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).