C13H14N2S2 — CID 132993214
4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid (PubChem CID 132993214) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid.
| Compound Name | 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid |
|---|---|
| PubChem CID | 132993214 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-benzyl-3,5-dimethylpyrazole-1-carbodithioic acid |
| SMILES | Cc1nn(C(=S)S)c(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C13H14N2S2/c1-9-12(8-11-6-4-3-5-7-11)10(2)15(14-9)13(16)17/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | FUEIMQFQNAQCKP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|