C25H27N5OS — CID 46263558
2-(4-benzyl-3,5-dimethylpyrazol-1-yl)-N-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 46263558) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-(4-benzyl-3,5-dimethylpyrazol-1-yl)-N-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-benzyl-3,5-dimethylpyrazol-1-yl)-N-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46263558 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-(4-benzyl-3,5-dimethylpyrazol-1-yl)-N-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-n2nc(C)c(Cc3ccccc3)c2C)sc1C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H27N5OS/c1-16-22(15-19-9-7-6-8-10-19)18(3)30(28-16)25-26-17(2)23(32-25)24(31)27-20-11-13-21(14-12-20)29(4)5/h6-14H,15H2,1-5H3,(H,27,31) |
| InChIKey | TVGIWACHRZYIHD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|