C18H20N4OS — CID 53134309
N-[4-(dimethylamino)phenyl]-4-ethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 53134309) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-ethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-ethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53134309 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-ethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(-n2cccc2)sc1C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-4-15-16(24-18(20-15)22-11-5-6-12-22)17(23)19-13-7-9-14(10-8-13)21(2)3/h5-12H,4H2,1-3H3,(H,19,23) |
| InChIKey | BRAVNZLOVYQWNN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|