C20H22N4O2S — CID 51054339
N-(4-acetamidophenyl)-4-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 51054339) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-4-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 51054339 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(4-acetamidophenyl)-4-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1nc(-n2cccc2)sc1C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-3-4-7-17-18(27-20(23-17)24-12-5-6-13-24)19(26)22-16-10-8-15(9-11-16)21-14(2)25/h5-6,8-13H,3-4,7H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | AQAJGPRCZYPNLM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |