C24H22N2O3S — CID 71830005
2-benzyl-3-[[4-(dimethylamino)phenyl]methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one (PubChem CID 71830005) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-benzyl-3-[[4-(dimethylamino)phenyl]methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one.
| Compound Name | 2-benzyl-3-[[4-(dimethylamino)phenyl]methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 71830005 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-benzyl-3-[[4-(dimethylamino)phenyl]methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one |
| SMILES | CN(C)c1ccc(C=C2C(=O)c3ccccc3S(=O)(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O3S/c1-25(2)20-14-12-18(13-15-20)16-22-24(27)21-10-6-7-11-23(21)30(28,29)26(22)17-19-8-4-3-5-9-19/h3-16H,17H2,1-2H3 |
| InChIKey | ADGYLAQWKIOZTP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|