C23H20N2O3S — CID 71965035
1,1-dioxo-2-(3-phenylpropyl)-3-(pyridin-3-ylmethylidene)-1λ6,2-benzothiazin-4-one (PubChem CID 71965035) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 1,1-dioxo-2-(3-phenylpropyl)-3-(pyridin-3-ylmethylidene)-1λ6,2-benzothiazin-4-one.
| Compound Name | 1,1-dioxo-2-(3-phenylpropyl)-3-(pyridin-3-ylmethylidene)-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 71965035 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1,1-dioxo-2-(3-phenylpropyl)-3-(pyridin-3-ylmethylidene)-1λ6,2-benzothiazin-4-one |
| SMILES | O=C1C(=Cc2cccnc2)N(CCCc2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C23H20N2O3S/c26-23-20-12-4-5-13-22(20)29(27,28)25(15-7-11-18-8-2-1-3-9-18)21(23)16-19-10-6-14-24-17-19/h1-6,8-10,12-14,16-17H,7,11,15H2 |
| InChIKey | PCAUHLINFHTSSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|