C23H19NO4S — CID 75179979
3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-(2-phenylethyl)-1λ6,2-benzothiazin-4-one (PubChem CID 75179979) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-(2-phenylethyl)-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-(2-phenylethyl)-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 75179979 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-(2-phenylethyl)-1λ6,2-benzothiazin-4-one |
| SMILES | O=C1C(=C(O)c2ccccc2)N(CCc2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C23H19NO4S/c25-22(18-11-5-2-6-12-18)21-23(26)19-13-7-8-14-20(19)29(27,28)24(21)16-15-17-9-3-1-4-10-17/h1-14,25H,15-16H2 |
| InChIKey | MHTWWQJQPSDLTG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|