C28H29N3O4S — CID 155549972
(3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-[3-(4-phenylpiperazin-1-yl)propyl]-1λ6,2-benzothiazin-4-one (PubChem CID 155549972) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-[3-(4-phenylpiperazin-1-yl)propyl]-1λ6,2-benzothiazin-4-one.
| Compound Name | (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-[3-(4-phenylpiperazin-1-yl)propyl]-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 155549972 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-[3-(4-phenylpiperazin-1-yl)propyl]-1λ6,2-benzothiazin-4-one |
| SMILES | O=C1/C(=C(/O)c2ccccc2)N(CCCN2CCN(c3ccccc3)CC2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O4S/c32-27(22-10-3-1-4-11-22)26-28(33)24-14-7-8-15-25(24)36(34,35)31(26)17-9-16-29-18-20-30(21-19-29)23-12-5-2-6-13-23/h1-8,10-15,32H,9,16-21H2/b27-26- |
| InChIKey | AYSJSNNPZNWHDA-RQZHXJHFSA-N |
| XLogP | 4.01 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|