C18H15NO6S — CID 67994851
3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-ethyl-1,1-dioxo-1λ6,2-benzothiazin-4-one (PubChem CID 67994851) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-ethyl-1,1-dioxo-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-ethyl-1,1-dioxo-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 67994851 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-ethyl-1,1-dioxo-1λ6,2-benzothiazin-4-one |
| SMILES | CCN1C(=C(O)c2ccc3c(c2)OCO3)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H15NO6S/c1-2-19-16(17(20)11-7-8-13-14(9-11)25-10-24-13)18(21)12-5-3-4-6-15(12)26(19,22)23/h3-9,20H,2,10H2,1H3 |
| InChIKey | GANCUQHGJMZCEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|