C23H17NO5S — CID 1042998
3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-phenacyl-1lambda6,2-benzothiazin-4-one (PubChem CID 1042998) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-phenacyl-1lambda6,2-benzothiazin-4-one.
| Compound Name | 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-phenacyl-1lambda6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 1042998 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[hydroxy(phenyl)methylidene]-1,1-dioxo-2-phenacyl-1lambda6,2-benzothiazin-4-one |
| SMILES | O=C(CN1C(=C(O)c2ccccc2)C(=O)c2ccccc2S1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C23H17NO5S/c25-19(16-9-3-1-4-10-16)15-24-21(22(26)17-11-5-2-6-12-17)23(27)18-13-7-8-14-20(18)30(24,28)29/h1-14,26H,15H2 |
| InChIKey | LFTBFRCWCUHJIO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|