C21H23NO4S — CID 53399792
3-[(4-methoxyphenyl)methylidene]-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-one (PubChem CID 53399792) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylidene]-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-[(4-methoxyphenyl)methylidene]-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 53399792 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylidene]-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-one |
| SMILES | CCCCCN1C(=Cc2ccc(OC)cc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H23NO4S/c1-3-4-7-14-22-19(15-16-10-12-17(26-2)13-11-16)21(23)18-8-5-6-9-20(18)27(22,24)25/h5-6,8-13,15H,3-4,7,14H2,1-2H3 |
| InChIKey | GNVKCOZOVKREQA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|