C15H13NO6S3 — CID 23523719
2-[(4-methoxyphenyl)sulfonylsulfanylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 23523719) has the molecular formula C15H13NO6S3 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylsulfanylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylsulfanylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 23523719 |
| Molecular Formula | C15H13NO6S3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylsulfanylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1ccc(S(=O)(=O)SCN2C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C15H13NO6S3/c1-22-11-6-8-12(9-7-11)25(20,21)23-10-16-15(17)13-4-2-3-5-14(13)24(16,18)19/h2-9H,10H2,1H3 |
| InChIKey | YUZWKYBWFYIWOX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|