C26H26N4O9S2 — CID 54310983
N-[4-[[(2R)-1-(hydroxyamino)-1-oxo-5-(1,1,3-trioxo-1,2-benzothiazol-2-yl)pentan-2-yl]sulfamoyl]phenyl]-4-methoxybenzamide (PubChem CID 54310983) has the molecular formula C26H26N4O9S2 and a molecular weight of 602.65 g/mol. Its IUPAC name is N-[4-[[(2R)-1-(hydroxyamino)-1-oxo-5-(1,1,3-trioxo-1,2-benzothiazol-2-yl)pentan-2-yl]sulfamoyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[[(2R)-1-(hydroxyamino)-1-oxo-5-(1,1,3-trioxo-1,2-benzothiazol-2-yl)pentan-2-yl]sulfamoyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 54310983 |
| Molecular Formula | C26H26N4O9S2 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | N-[4-[[(2R)-1-(hydroxyamino)-1-oxo-5-(1,1,3-trioxo-1,2-benzothiazol-2-yl)pentan-2-yl]sulfamoyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(S(=O)(=O)N[C@H](CCCN3C(=O)c4ccccc4S3(=O)=O)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O9S2/c1-39-19-12-8-17(9-13-19)24(31)27-18-10-14-20(15-11-18)40(35,36)29-22(25(32)28-34)6-4-16-30-26(33)21-5-2-3-7-23(21)41(30,37)38/h2-3,5,7-15,22,29,34H,4,6,16H2,1H3,(H,27,31)(H,28,32)/t22-/m1/s1 |
| InChIKey | SKWAFQFJZBIEKR-JOCHJYFZSA-N |
| XLogP | 1.72 |
| TPSA | 188.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|