C24H29N5O6S — CID 10229563
(2R)-5-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylamino]pentanamide (PubChem CID 10229563) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is (2R)-5-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylamino]pentanamide.
| Compound Name | (2R)-5-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 10229563 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (2R)-5-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylamino]pentanamide |
| SMILES | CN1CCN(c2ccc(S(=O)(=O)N[C@H](CCCN3C(=O)c4ccccc4C3=O)C(=O)NO)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O6S/c1-27-13-15-28(16-14-27)17-8-10-18(11-9-17)36(34,35)26-21(22(30)25-33)7-4-12-29-23(31)19-5-2-3-6-20(19)24(29)32/h2-3,5-6,8-11,21,26,33H,4,7,12-16H2,1H3,(H,25,30)/t21-/m1/s1 |
| InChIKey | DIDAWZVOEFNSBW-OAQYLSRUSA-N |
| XLogP | 0.67 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|