C16H26ClN5O4S — CID 18727269
(2R)-6-amino-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxyhexanamide (PubChem CID 18727269) has the molecular formula C16H26ClN5O4S and a molecular weight of 419.94 g/mol. Its IUPAC name is (2R)-6-amino-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxyhexanamide.
| Compound Name | (2R)-6-amino-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 18727269 |
| Molecular Formula | C16H26ClN5O4S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R)-6-amino-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxyhexanamide |
| SMILES | NCCCC[C@@H](NS(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C16H26ClN5O4S/c17-13-4-6-14(7-5-13)21-9-11-22(12-10-21)27(25,26)20-15(16(23)19-24)3-1-2-8-18/h4-7,15,20,24H,1-3,8-12,18H2,(H,19,23)/t15-/m1/s1 |
| InChIKey | CJXAUAYBKVMVBE-OAHLLOKOSA-N |
| XLogP | 0.30 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|