C16H25Cl3N4O2 — CID 119871517
4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]butanamide;dihydrochloride (PubChem CID 119871517) has the molecular formula C16H25Cl3N4O2 and a molecular weight of 411.76 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119871517 |
| Molecular Formula | C16H25Cl3N4O2 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN4O2.2ClH/c17-13-3-5-14(6-4-13)20-8-10-21(11-9-20)16(23)12-19-15(22)2-1-7-18;;/h3-6H,1-2,7-12,18H2,(H,19,22);2*1H |
| InChIKey | UVGLNWRCHGWYCH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |