C17H27Cl3N4O2 — CID 120565211
4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]pentanamide;dihydrochloride (PubChem CID 120565211) has the molecular formula C17H27Cl3N4O2 and a molecular weight of 425.79 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120565211 |
| Molecular Formula | C17H27Cl3N4O2 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H25ClN4O2.2ClH/c1-13(19)2-7-16(23)20-12-17(24)22-10-8-21(9-11-22)15-5-3-14(18)4-6-15;;/h3-6,13H,2,7-12,19H2,1H3,(H,20,23);2*1H |
| InChIKey | LBWFCSKKTWJRKL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |