C17H25ClN4O3 — CID 120596278
4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methoxybutanamide (PubChem CID 120596278) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120596278 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-amino-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H25ClN4O3/c1-25-15(11-19)10-16(23)20-12-17(24)22-8-6-21(7-9-22)14-4-2-13(18)3-5-14/h2-5,15H,6-12,19H2,1H3,(H,20,23) |
| InChIKey | WWDSIYGJCSKWSR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |