C19H20ClFN4O2 — CID 110371137
1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]urea (PubChem CID 110371137) has the molecular formula C19H20ClFN4O2 and a molecular weight of 390.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 110371137 |
| Molecular Formula | C19H20ClFN4O2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClFN4O2/c20-14-1-5-16(6-2-14)23-19(27)22-13-18(26)25-11-9-24(10-12-25)17-7-3-15(21)4-8-17/h1-8H,9-13H2,(H2,22,23,27) |
| InChIKey | YBBGQYWIXBYVOI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |