C25H24ClFN4O2 — CID 67164199
1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea (PubChem CID 67164199) has the molecular formula C25H24ClFN4O2 and a molecular weight of 466.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea |
|---|---|
| PubChem CID | 67164199 |
| Molecular Formula | C25H24ClFN4O2 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC(C(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H24ClFN4O2/c26-19-6-10-21(11-7-19)28-25(33)29-23(18-4-2-1-3-5-18)24(32)31-16-14-30(15-17-31)22-12-8-20(27)9-13-22/h1-13,23H,14-17H2,(H2,28,29,33) |
| InChIKey | PJYOTIORUIARDI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |