C26H27ClN4O3 — CID 174499120
1-(4-chlorophenyl)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea (PubChem CID 174499120) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea |
|---|---|
| PubChem CID | 174499120 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxo-1-phenylethyl]urea |
| SMILES | COc1cccc(N2CCN(C(=O)C(NC(=O)Nc3ccc(Cl)cc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-34-23-9-5-8-22(18-23)30-14-16-31(17-15-30)25(32)24(19-6-3-2-4-7-19)29-26(33)28-21-12-10-20(27)11-13-21/h2-13,18,24H,14-17H2,1H3,(H2,28,29,33) |
| InChIKey | CFCUDYNXNHSNIV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |