C13H17FN4O2 — CID 61177229
1-(4-fluorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea (PubChem CID 61177229) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 61177229 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCC(=O)N1CCNCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN4O2/c14-10-1-3-11(4-2-10)17-13(20)16-9-12(19)18-7-5-15-6-8-18/h1-4,15H,5-9H2,(H2,16,17,20) |
| InChIKey | WHUHGDPUBDEJFT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |