C21H27ClN4O3 — CID 156825295
1-[(4-chlorophenyl)methyl]-3-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]urea;methanol (PubChem CID 156825295) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]urea;methanol.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]urea;methanol |
|---|---|
| PubChem CID | 156825295 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]urea;methanol |
| SMILES | CO.O=C(NCc1ccc(Cl)cc1)Nc1ccc(CC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C20H23ClN4O2.CH4O/c21-17-5-1-16(2-6-17)14-23-20(27)24-18-7-3-15(4-8-18)13-19(26)25-11-9-22-10-12-25;1-2/h1-8,22H,9-14H2,(H2,23,24,27);2H,1H3 |
| InChIKey | KUFHGOJCRSINOL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |