C13H16Cl2N4O2 — CID 107654016
1-(3,5-dichlorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea (PubChem CID 107654016) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 107654016 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCC(=O)N1CCNCC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N4O2/c14-9-5-10(15)7-11(6-9)18-13(21)17-8-12(20)19-3-1-16-2-4-19/h5-7,16H,1-4,8H2,(H2,17,18,21) |
| InChIKey | JGCYQMNQLBPSKR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |