C13H15ClFN3O2 — CID 61177799
4-chloro-2-fluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide (PubChem CID 61177799) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide.
| Compound Name | 4-chloro-2-fluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 61177799 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-chloro-2-fluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCNCC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H15ClFN3O2/c14-9-1-2-10(11(15)7-9)13(20)17-8-12(19)18-5-3-16-4-6-18/h1-2,7,16H,3-6,8H2,(H,17,20) |
| InChIKey | CQSMSMFNBOFYOP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |