C14H18FN3O2 — CID 63213553
4-fluoro-3-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide (PubChem CID 63213553) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide.
| Compound Name | 4-fluoro-3-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 63213553 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-fluoro-3-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
| SMILES | Cc1cc(C(=O)NCC(=O)N2CCNCC2)ccc1F |
| InChI | InChI=1S/C14H18FN3O2/c1-10-8-11(2-3-12(10)15)14(20)17-9-13(19)18-6-4-16-5-7-18/h2-3,8,16H,4-7,9H2,1H3,(H,17,20) |
| InChIKey | IJFUMVWFGCFBBM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |