C20H25ClN4O4S — CID 18727267
(2R)-2-[benzyl-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypropanamide (PubChem CID 18727267) has the molecular formula C20H25ClN4O4S and a molecular weight of 452.96 g/mol. Its IUPAC name is (2R)-2-[benzyl-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[benzyl-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 18727267 |
| Molecular Formula | C20H25ClN4O4S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (2R)-2-[benzyl-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypropanamide |
| SMILES | C[C@H](C(=O)NO)N(Cc1ccccc1)S(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN4O4S/c1-16(20(26)22-27)25(15-17-5-3-2-4-6-17)30(28,29)24-13-11-23(12-14-24)19-9-7-18(21)8-10-19/h2-10,16,27H,11-15H2,1H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | JUZWEVXSXSWGTG-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|