C23H29ClN4O2 — CID 167938428
N'-[(4-chlorophenyl)methyl]-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]oxamide (PubChem CID 167938428) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]oxamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 167938428 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]oxamide |
| SMILES | CC(CNC(=O)C(=O)N(C)Cc1ccc(Cl)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-18(27-12-14-28(15-13-27)21-6-4-3-5-7-21)16-25-22(29)23(30)26(2)17-19-8-10-20(24)11-9-19/h3-11,18H,12-17H2,1-2H3,(H,25,29) |
| InChIKey | BCLNJRLWFYCCST-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|