C20H22ClN3O2 — CID 108518852
N-benzyl-2-[4-(3-chlorophenyl)piperazin-1-yl]-N-methyl-2-oxoacetamide (PubChem CID 108518852) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-benzyl-2-[4-(3-chlorophenyl)piperazin-1-yl]-N-methyl-2-oxoacetamide.
| Compound Name | N-benzyl-2-[4-(3-chlorophenyl)piperazin-1-yl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 108518852 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-benzyl-2-[4-(3-chlorophenyl)piperazin-1-yl]-N-methyl-2-oxoacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-22(15-16-6-3-2-4-7-16)19(25)20(26)24-12-10-23(11-13-24)18-9-5-8-17(21)14-18/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | WRACVPGQRFIULZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|