C19H26ClN3O2 — CID 108524936
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,6-dimethylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 108524936) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,6-dimethylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,6-dimethylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108524936 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,6-dimethylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | CC1CCCC(C)N1C(=O)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-14-5-3-6-15(2)23(14)19(25)18(24)22-11-9-21(10-12-22)17-8-4-7-16(20)13-17/h4,7-8,13-15H,3,5-6,9-12H2,1-2H3 |
| InChIKey | JELWAVLAZBMGQH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|