C15H19ClN2O2 — CID 108516493
N-(3-chlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108516493) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108516493 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | CC1CCCC(C)N1C(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-10-5-3-6-11(2)18(10)15(20)14(19)17-13-8-4-7-12(16)9-13/h4,7-11H,3,5-6H2,1-2H3,(H,17,19) |
| InChIKey | BOTKNMQKEQSASY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|