C16H20ClN3O2 — CID 129429874
2-[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3-chlorophenyl)-2-oxoacetamide (PubChem CID 129429874) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3-chlorophenyl)-2-oxoacetamide.
| Compound Name | 2-[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3-chlorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 129429874 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(3-chlorophenyl)-2-oxoacetamide |
| SMILES | C[C@@H]1CN2CCC[C@H]2CN1C(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-11-9-19-7-3-6-14(19)10-20(11)16(22)15(21)18-13-5-2-4-12(17)8-13/h2,4-5,8,11,14H,3,6-7,9-10H2,1H3,(H,18,21)/t11-,14+/m1/s1 |
| InChIKey | SEIRROIKJQDMQY-RISCZKNCSA-N |
| XLogP | 1.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|