C15H19ClN2O2 — CID 106501985
(2-chloro-5-hydroxyphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 106501985) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (2-chloro-5-hydroxyphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (2-chloro-5-hydroxyphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 106501985 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2-chloro-5-hydroxyphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC1CN2CCCC2CN1C(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C15H19ClN2O2/c1-10-8-17-6-2-3-11(17)9-18(10)15(20)13-7-12(19)4-5-14(13)16/h4-5,7,10-11,19H,2-3,6,8-9H2,1H3 |
| InChIKey | TVQPWVGTYLNYRM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |