C16H20Br2N2O — CID 103882887
(2,4-dibromophenyl)-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone (PubChem CID 103882887) has the molecular formula C16H20Br2N2O and a molecular weight of 416.16 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (2,4-dibromophenyl)-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 103882887 |
| Molecular Formula | C16H20Br2N2O |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (2,4-dibromophenyl)-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC1CN2CCCCC2CN1C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H20Br2N2O/c1-11-9-19-7-3-2-4-13(19)10-20(11)16(21)14-6-5-12(17)8-15(14)18/h5-6,8,11,13H,2-4,7,9-10H2,1H3 |
| InChIKey | OUUGMRKBPFSOFU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |