C14H20N2OS — CID 78992376
(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-thiophen-2-ylmethanone (PubChem CID 78992376) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is (3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-thiophen-2-ylmethanone.
| Compound Name | (3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 78992376 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-thiophen-2-ylmethanone |
| SMILES | CC1CN2CCCCC2CN1C(=O)c1cccs1 |
| InChI | InChI=1S/C14H20N2OS/c1-11-9-15-7-3-2-5-12(15)10-16(11)14(17)13-6-4-8-18-13/h4,6,8,11-12H,2-3,5,7,9-10H2,1H3 |
| InChIKey | QUWUABNLTMAHMF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |