C16H20Br2N2O — CID 103882570
(2,4-dibromophenyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 103882570) has the molecular formula C16H20Br2N2O and a molecular weight of 416.16 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | (2,4-dibromophenyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103882570 |
| Molecular Formula | C16H20Br2N2O |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (2,4-dibromophenyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1Br)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C16H20Br2N2O/c17-12-5-6-14(15(18)10-12)16(21)20-9-3-4-13(11-20)19-7-1-2-8-19/h5-6,10,13H,1-4,7-9,11H2 |
| InChIKey | ZBYYHDDQVPBQLG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |