C15H18BrClN2O — CID 95271389
(5-bromo-2-chlorophenyl)-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone (PubChem CID 95271389) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone.
| Compound Name | (5-bromo-2-chlorophenyl)-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95271389 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1Cl)N1CC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C15H18BrClN2O/c16-11-3-4-14(17)13(9-11)15(20)19-8-5-12(10-19)18-6-1-2-7-18/h3-4,9,12H,1-2,5-8,10H2/t12-/m1/s1 |
| InChIKey | HWJFLFXOONUTNR-GFCCVEGCSA-N |
| XLogP | 3.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |