C15H18Br2N2O — CID 103908312
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(3,5-dibromophenyl)methanone (PubChem CID 103908312) has the molecular formula C15H18Br2N2O and a molecular weight of 402.13 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(3,5-dibromophenyl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(3,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 103908312 |
| Molecular Formula | C15H18Br2N2O |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(3,5-dibromophenyl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C15H18Br2N2O/c16-12-7-11(8-13(17)9-12)15(20)19-6-5-18-4-2-1-3-14(18)10-19/h7-9,14H,1-6,10H2 |
| InChIKey | IUXJYNZCYUHDKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |