C17H21N3O — CID 136525720
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(indolizin-2-yl)methanone (PubChem CID 136525720) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(indolizin-2-yl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(indolizin-2-yl)methanone |
|---|---|
| PubChem CID | 136525720 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(indolizin-2-yl)methanone |
| SMILES | O=C(c1cc2ccccn2c1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C17H21N3O/c21-17(14-11-15-5-1-4-8-19(15)12-14)20-10-9-18-7-3-2-6-16(18)13-20/h1,4-5,8,11-12,16H,2-3,6-7,9-10,13H2 |
| InChIKey | VVVYCUZAJXGQHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |