C17H23N3O — CID 103998528
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(2,3-dihydro-1H-isoindol-5-yl)methanone (PubChem CID 103998528) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(2,3-dihydro-1H-isoindol-5-yl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(2,3-dihydro-1H-isoindol-5-yl)methanone |
|---|---|
| PubChem CID | 103998528 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(2,3-dihydro-1H-isoindol-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CNC2)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C17H23N3O/c21-17(13-4-5-14-10-18-11-15(14)9-13)20-8-7-19-6-2-1-3-16(19)12-20/h4-5,9,16,18H,1-3,6-8,10-12H2 |
| InChIKey | CAGTWCNXLFQHOI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |