C18H25N3O — CID 25060401
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(1,2,3,4-tetrahydroisoquinolin-6-yl)methanone (PubChem CID 25060401) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(1,2,3,4-tetrahydroisoquinolin-6-yl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(1,2,3,4-tetrahydroisoquinolin-6-yl)methanone |
|---|---|
| PubChem CID | 25060401 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl(1,2,3,4-tetrahydroisoquinolin-6-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCNC2)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C18H25N3O/c22-18(15-4-5-16-12-19-7-6-14(16)11-15)21-10-9-20-8-2-1-3-17(20)13-21/h4-5,11,17,19H,1-3,6-10,12-13H2 |
| InChIKey | BDXYHHJQMBRNQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |