C21H31N3O — CID 25061941
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-6-yl)methanone (PubChem CID 25061941) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-6-yl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-6-yl)methanone |
|---|---|
| PubChem CID | 25061941 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-6-yl)methanone |
| SMILES | CC(C)N1CCc2cc(C(=O)N3CCN4CCCCC4C3)ccc2C1 |
| InChI | InChI=1S/C21H31N3O/c1-16(2)23-10-8-17-13-18(6-7-19(17)14-23)21(25)24-12-11-22-9-4-3-5-20(22)15-24/h6-7,13,16,20H,3-5,8-12,14-15H2,1-2H3 |
| InChIKey | WNJVQURFLKUHOY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |