C13H17BrN2OS — CID 95589911
[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-bromothiophen-2-yl)methanone (PubChem CID 95589911) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-bromothiophen-2-yl)methanone.
| Compound Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-bromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 95589911 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-bromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C13H17BrN2OS/c14-10-7-12(18-9-10)13(17)16-6-5-15-4-2-1-3-11(15)8-16/h7,9,11H,1-6,8H2/t11-/m0/s1 |
| InChIKey | BLJRFIXXHBEYBL-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |