C17H22ClN3O2 — CID 95615028
N'-(3-chlorophenyl)-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]oxamide (PubChem CID 95615028) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]oxamide.
| Compound Name | N'-(3-chlorophenyl)-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]oxamide |
|---|---|
| PubChem CID | 95615028 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N'-(3-chlorophenyl)-N-[(3R)-1-cyclopentylpyrrolidin-3-yl]oxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(=O)N[C@@H]1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C17H22ClN3O2/c18-12-4-3-5-13(10-12)19-16(22)17(23)20-14-8-9-21(11-14)15-6-1-2-7-15/h3-5,10,14-15H,1-2,6-9,11H2,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | QEJULGNSHFIIKA-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|