C19H24N4O2 — CID 95615021
N'-[4-(cyanomethyl)phenyl]-N-[(3S)-1-cyclopentylpyrrolidin-3-yl]oxamide (PubChem CID 95615021) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N'-[4-(cyanomethyl)phenyl]-N-[(3S)-1-cyclopentylpyrrolidin-3-yl]oxamide.
| Compound Name | N'-[4-(cyanomethyl)phenyl]-N-[(3S)-1-cyclopentylpyrrolidin-3-yl]oxamide |
|---|---|
| PubChem CID | 95615021 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N'-[4-(cyanomethyl)phenyl]-N-[(3S)-1-cyclopentylpyrrolidin-3-yl]oxamide |
| SMILES | N#CCc1ccc(NC(=O)C(=O)N[C@H]2CCN(C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C19H24N4O2/c20-11-9-14-5-7-15(8-6-14)21-18(24)19(25)22-16-10-12-23(13-16)17-3-1-2-4-17/h5-8,16-17H,1-4,9-10,12-13H2,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | PABFUMWFHOUGPH-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|